C16H22ClF2N3 — CID 143338913
(E)-N'-(1-amino-2-methylprop-1-enyl)-3-chloro-N-[(2E,4E)-1,5-difluoro-6-methylhepta-2,4,6-trien-3-yl]but-2-enimidamide (PubChem CID 143338913) has the molecular formula C16H22ClF2N3 and a molecular weight of 329.82 g/mol. Its IUPAC name is (E)-N'-(1-amino-2-methylprop-1-enyl)-3-chloro-N-[(2E,4E)-1,5-difluoro-6-methylhepta-2,4,6-trien-3-yl]but-2-enimidamide.
| Compound Name | (E)-N'-(1-amino-2-methylprop-1-enyl)-3-chloro-N-[(2E,4E)-1,5-difluoro-6-methylhepta-2,4,6-trien-3-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 143338913 |
| Molecular Formula | C16H22ClF2N3 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (E)-N'-(1-amino-2-methylprop-1-enyl)-3-chloro-N-[(2E,4E)-1,5-difluoro-6-methylhepta-2,4,6-trien-3-yl]but-2-enimidamide |
| SMILES | C=C(C)/C(F)=C\C(=C/CF)NC(/C=C(\C)Cl)=N/C(N)=C(C)C |
| InChI | InChI=1S/C16H22ClF2N3/c1-10(2)14(19)9-13(6-7-18)21-15(8-12(5)17)22-16(20)11(3)4/h6,8-9H,1,7,20H2,2-5H3,(H,21,22)/b12-8+,13-6+,14-9+ |
| InChIKey | ARZZJTOBIRWIOW-YEFXBZOFSA-N |
| XLogP | 4.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|