C21H29N3 — CID 142950039
N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-N'-[[(3E,5E,7E)-6-methylnona-1,3,5,7-tetraen-3-yl]iminomethyl]ethanimidamide (PubChem CID 142950039) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-N'-[[(3E,5E,7E)-6-methylnona-1,3,5,7-tetraen-3-yl]iminomethyl]ethanimidamide.
| Compound Name | N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-N'-[[(3E,5E,7E)-6-methylnona-1,3,5,7-tetraen-3-yl]iminomethyl]ethanimidamide |
|---|---|
| PubChem CID | 142950039 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-[(2E,4Z)-5-methylhepta-2,4,6-trien-3-yl]-N'-[[(3E,5E,7E)-6-methylnona-1,3,5,7-tetraen-3-yl]iminomethyl]ethanimidamide |
| SMILES | C=C/C(C)=C\C(=C/C)N/C(C)=N/C=N/C(C=C)=C/C=C(C)/C=C/C |
| InChI | InChI=1S/C21H29N3/c1-8-12-18(6)13-14-20(10-3)23-16-22-19(7)24-21(11-4)15-17(5)9-2/h8-16H,2-3H2,1,4-7H3,(H,22,23,24)/b12-8+,17-15-,18-13+,20-14+,21-11+ |
| InChIKey | IOKQGFWIFTYTRR-ACKSVPBJSA-N |
| XLogP | 5.65 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|