C25H45N — CID 123178243
4,4,9-trimethyl-13-prop-1-en-2-yl-9-propylhexadec-11-yn-2-imine (PubChem CID 123178243) has the molecular formula C25H45N and a molecular weight of 359.64 g/mol. Its IUPAC name is 4,4,9-trimethyl-13-prop-1-en-2-yl-9-propylhexadec-11-yn-2-imine.
| Compound Name | 4,4,9-trimethyl-13-prop-1-en-2-yl-9-propylhexadec-11-yn-2-imine |
|---|---|
| PubChem CID | 123178243 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | 4,4,9-trimethyl-13-prop-1-en-2-yl-9-propylhexadec-11-yn-2-imine |
| SMILES | [H]/N=C(\C)CC(C)(C)CCCCC(C)(CC#CC(CCC)C(=C)C)CCC |
| InChI | InChI=1S/C25H45N/c1-9-14-23(21(3)4)15-13-19-25(8,16-10-2)18-12-11-17-24(6,7)20-22(5)26/h23,26H,3,9-12,14,16-20H2,1-2,4-8H3/b26-22+ |
| InChIKey | DBZHZDNGOUAOHU-XTCLZLMSSA-N |
| XLogP | 8.20 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|