About 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one
3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one (PubChem CID 123178272) has the molecular formula C9H21NOS2
and a molecular weight of 223.41 g/mol. Its IUPAC name is 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one.
Molecular Properties
| Compound Name | 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one |
| PubChem CID | 123178272 |
| Molecular Formula | C9H21NOS2 |
| Molecular Weight | 223.41 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one |
| SMILES | CC(=O)C(C(C)C)N(C)S(C)(C)S |
| InChI | InChI=1S/C9H21NOS2/c1-7(2)9(8(3)11)10(4)13(5,6)12/h7,9,12H,1-6H3 |
| InChIKey | DGTSMYCPPPIZDJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one?
The IUPAC name of 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one (CID 123178272) is 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one.
What is the SMILES notation for 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one?
The canonical SMILES for 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one is CC(=O)C(C(C)C)N(C)S(C)(C)S.
What is the InChIKey of 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one?
The InChIKey is DGTSMYCPPPIZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NOS2/c1-7(2)9(8(3)11)10(4)13(5,6)12/h7,9,12H,1-6H3.
What are the key properties of 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one?
3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one has a molecular weight of 223.41 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[dimethyl(sulfanyl)-λ4-sulfanyl]-methylamino]-4-methylpentan-2-one is sourced from PubChem (CID 123178272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).