C18H29NO4 — CID 123178430
3-[(2,4-dihydroxyphenyl)methyl]-N-heptyl-4-hydroxybutanamide (PubChem CID 123178430) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 3-[(2,4-dihydroxyphenyl)methyl]-N-heptyl-4-hydroxybutanamide.
| Compound Name | 3-[(2,4-dihydroxyphenyl)methyl]-N-heptyl-4-hydroxybutanamide |
|---|---|
| PubChem CID | 123178430 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 3-[(2,4-dihydroxyphenyl)methyl]-N-heptyl-4-hydroxybutanamide |
| SMILES | CCCCCCCNC(=O)CC(CO)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C18H29NO4/c1-2-3-4-5-6-9-19-18(23)11-14(13-20)10-15-7-8-16(21)12-17(15)22/h7-8,12,14,20-22H,2-6,9-11,13H2,1H3,(H,19,23) |
| InChIKey | JONMFDYYKDGLEN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|