C23H18ClFN6O2 — CID 123180771
3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(4-fluoro-3-methoxyphenyl)isoquinolin-1-one (PubChem CID 123180771) has the molecular formula C23H18ClFN6O2 and a molecular weight of 464.89 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(4-fluoro-3-methoxyphenyl)isoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(4-fluoro-3-methoxyphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 123180771 |
| Molecular Formula | C23H18ClFN6O2 |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(4-fluoro-3-methoxyphenyl)isoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(Cl)c2c(=O)n1-c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C23H18ClFN6O2/c1-12(29-21-17(27-2)11-28-23(26)30-21)18-9-13-5-4-6-15(24)20(13)22(32)31(18)14-7-8-16(25)19(10-14)33-3/h4-12H,1,3H3,(H3,26,28,29,30)/t12-/m0/s1 |
| InChIKey | AQRLKMIFNICGMW-LBPRGKRZSA-N |
| XLogP | 4.89 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|