C19H14ClN7OS — CID 123287350
3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(1,3-thiazol-4-yl)isoquinolin-1-one (PubChem CID 123287350) has the molecular formula C19H14ClN7OS and a molecular weight of 423.89 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(1,3-thiazol-4-yl)isoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(1,3-thiazol-4-yl)isoquinolin-1-one |
|---|---|
| PubChem CID | 123287350 |
| Molecular Formula | C19H14ClN7OS |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-(1,3-thiazol-4-yl)isoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(Cl)c2c(=O)n1-c1cscn1 |
| InChI | InChI=1S/C19H14ClN7OS/c1-10(25-17-13(22-2)7-23-19(21)26-17)14-6-11-4-3-5-12(20)16(11)18(28)27(14)15-8-29-9-24-15/h3-10H,1H3,(H3,21,23,25,26)/t10-/m0/s1 |
| InChIKey | BERHOIMLHFYVBX-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|