C31H32N4O6 — CID 123180869
3-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]-4-(1-methylindol-5-yl)-5-oxo-1,2,4-triazole-1-carboxylic acid (PubChem CID 123180869) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is 3-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]-4-(1-methylindol-5-yl)-5-oxo-1,2,4-triazole-1-carboxylic acid.
| Compound Name | 3-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]-4-(1-methylindol-5-yl)-5-oxo-1,2,4-triazole-1-carboxylic acid |
|---|---|
| PubChem CID | 123180869 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 3-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]-4-(1-methylindol-5-yl)-5-oxo-1,2,4-triazole-1-carboxylic acid |
| SMILES | CCOCOc1cc(OCc2ccccc2)c(-c2nn(C(=O)O)c(=O)n2-c2ccc3c(ccn3C)c2)cc1C(C)C |
| InChI | InChI=1S/C31H32N4O6/c1-5-39-19-41-27-17-28(40-18-21-9-7-6-8-10-21)25(16-24(27)20(2)3)29-32-35(31(37)38)30(36)34(29)23-11-12-26-22(15-23)13-14-33(26)4/h6-17,20H,5,18-19H2,1-4H3,(H,37,38) |
| InChIKey | RRZCLRZMCDZLFZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|