C30H34N4O4 — CID 67340950
1-[(Z)-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]methylideneamino]-3-(1-methylindol-5-yl)urea (PubChem CID 67340950) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-[(Z)-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]methylideneamino]-3-(1-methylindol-5-yl)urea.
| Compound Name | 1-[(Z)-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]methylideneamino]-3-(1-methylindol-5-yl)urea |
|---|---|
| PubChem CID | 67340950 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 1-[(Z)-[4-(ethoxymethoxy)-2-phenylmethoxy-5-propan-2-ylphenyl]methylideneamino]-3-(1-methylindol-5-yl)urea |
| SMILES | CCOCOc1cc(OCc2ccccc2)c(/C=N\NC(=O)Nc2ccc3c(ccn3C)c2)cc1C(C)C |
| InChI | InChI=1S/C30H34N4O4/c1-5-36-20-38-29-17-28(37-19-22-9-7-6-8-10-22)24(16-26(29)21(2)3)18-31-33-30(35)32-25-11-12-27-23(15-25)13-14-34(27)4/h6-18,21H,5,19-20H2,1-4H3,(H2,32,33,35)/b31-18- |
| InChIKey | AXGAIPPVGXQOJF-MNBJERMJSA-N |
| XLogP | 6.41 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|