C30H45N5O3 — CID 89248532
1-[(E)-(2,4-dibutoxy-5-propan-2-ylphenyl)methylideneamino]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea (PubChem CID 89248532) has the molecular formula C30H45N5O3 and a molecular weight of 523.72 g/mol. Its IUPAC name is 1-[(E)-(2,4-dibutoxy-5-propan-2-ylphenyl)methylideneamino]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[(E)-(2,4-dibutoxy-5-propan-2-ylphenyl)methylideneamino]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 89248532 |
| Molecular Formula | C30H45N5O3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | 1-[(E)-(2,4-dibutoxy-5-propan-2-ylphenyl)methylideneamino]-3-[4-(4-methylpiperazin-1-yl)phenyl]urea |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1/C=N/NC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C30H45N5O3/c1-6-8-18-37-28-21-29(38-19-9-7-2)27(23(3)4)20-24(28)22-31-33-30(36)32-25-10-12-26(13-11-25)35-16-14-34(5)15-17-35/h10-13,20-23H,6-9,14-19H2,1-5H3,(H2,32,33,36)/b31-22+ |
| InChIKey | GNXDENNXZMQHLQ-DFKUXCBWSA-N |
| XLogP | 6.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|