C36H37N3O5 — CID 59707335
1-[(E)-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]methylideneamino]-3-spiro[1,3-dihydroindene-2,2'-1,3-dioxolane]-5-ylurea (PubChem CID 59707335) has the molecular formula C36H37N3O5 and a molecular weight of 591.71 g/mol. Its IUPAC name is 1-[(E)-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]methylideneamino]-3-spiro[1,3-dihydroindene-2,2'-1,3-dioxolane]-5-ylurea.
| Compound Name | 1-[(E)-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]methylideneamino]-3-spiro[1,3-dihydroindene-2,2'-1,3-dioxolane]-5-ylurea |
|---|---|
| PubChem CID | 59707335 |
| Molecular Formula | C36H37N3O5 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 1-[(E)-[2,4-bis(phenylmethoxy)-5-propan-2-ylphenyl]methylideneamino]-3-spiro[1,3-dihydroindene-2,2'-1,3-dioxolane]-5-ylurea |
| SMILES | CC(C)c1cc(/C=N/NC(=O)Nc2ccc3c(c2)CC2(C3)OCCO2)c(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C36H37N3O5/c1-25(2)32-18-30(22-37-39-35(40)38-31-14-13-28-20-36(21-29(28)17-31)43-15-16-44-36)33(41-23-26-9-5-3-6-10-26)19-34(32)42-24-27-11-7-4-8-12-27/h3-14,17-19,22,25H,15-16,20-21,23-24H2,1-2H3,(H2,38,39,40)/b37-22+ |
| InChIKey | CBPAZMPCHJSXRA-SEBMTOOBSA-N |
| XLogP | 6.97 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|