C7H10N2O2 — CID 123185562
1,6-dimethyl-5H-1,3-diazepine-2,4-dione (PubChem CID 123185562) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1,6-dimethyl-5H-1,3-diazepine-2,4-dione.
| Compound Name | 1,6-dimethyl-5H-1,3-diazepine-2,4-dione |
|---|---|
| PubChem CID | 123185562 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1,6-dimethyl-5H-1,3-diazepine-2,4-dione |
| SMILES | CC1=CN(C)C(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H10N2O2/c1-5-3-6(10)8-7(11)9(2)4-5/h4H,3H2,1-2H3,(H,8,10,11) |
| InChIKey | SEIKCMGPFNZRFP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |