C26H26FN5O5 — CID 123187248
2-[4-[3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)prop-2-enoyl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 123187248) has the molecular formula C26H26FN5O5 and a molecular weight of 507.52 g/mol. Its IUPAC name is 2-[4-[3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)prop-2-enoyl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)prop-2-enoyl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123187248 |
| Molecular Formula | C26H26FN5O5 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[4-[3-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)prop-2-enoyl]piperazin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | COc1ccc(C=C(C(=O)N2CCN(c3ncc(C(=O)NO)cn3)CC2)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C26H26FN5O5/c1-36-22-8-7-17(14-23(22)37-2)13-20(19-5-3-4-6-21(19)27)25(34)31-9-11-32(12-10-31)26-28-15-18(16-29-26)24(33)30-35/h3-8,13-16,35H,9-12H2,1-2H3,(H,30,33) |
| InChIKey | HVGHCSGPSXNARV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|