C23H26N4OS — CID 123188505
[2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(1-methylsulfanylbuta-1,3-dienyl)phenyl]methanone (PubChem CID 123188505) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is [2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(1-methylsulfanylbuta-1,3-dienyl)phenyl]methanone.
| Compound Name | [2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(1-methylsulfanylbuta-1,3-dienyl)phenyl]methanone |
|---|---|
| PubChem CID | 123188505 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(1-methylsulfanylbuta-1,3-dienyl)phenyl]methanone |
| SMILES | C=CC=C(SC)c1ccccc1C(=O)N1CC2CN(c3nccc(C)n3)CC2C1 |
| InChI | InChI=1S/C23H26N4OS/c1-4-7-21(29-3)19-8-5-6-9-20(19)22(28)26-12-17-14-27(15-18(17)13-26)23-24-11-10-16(2)25-23/h4-11,17-18H,1,12-15H2,2-3H3 |
| InChIKey | AGXBDOXNRLXUIS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|