C23H23BrN4O — CID 67116806
(1-bromonaphthalen-2-yl)-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 67116806) has the molecular formula C23H23BrN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is (1-bromonaphthalen-2-yl)-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (1-bromonaphthalen-2-yl)-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 67116806 |
| Molecular Formula | C23H23BrN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (1-bromonaphthalen-2-yl)-[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4ccc5ccccc5c4Br)CC3C2)n1 |
| InChI | InChI=1S/C23H23BrN4O/c1-14-9-15(2)26-23(25-14)28-12-17-10-27(11-18(17)13-28)22(29)20-8-7-16-5-3-4-6-19(16)21(20)24/h3-9,17-18H,10-13H2,1-2H3 |
| InChIKey | NLRXSLXVPWHPJU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |