C22H22F2N6O — CID 70981830
[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(4-fluoro-1H-pyrazol-5-yl)phenyl]methanone (PubChem CID 70981830) has the molecular formula C22H22F2N6O and a molecular weight of 424.46 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(4-fluoro-1H-pyrazol-5-yl)phenyl]methanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(4-fluoro-1H-pyrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 70981830 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[3-fluoro-2-(4-fluoro-1H-pyrazol-5-yl)phenyl]methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4cccc(F)c4-c4[nH]ncc4F)CC3C2)n1 |
| InChI | InChI=1S/C22H22F2N6O/c1-12-6-13(2)27-22(26-12)30-10-14-8-29(9-15(14)11-30)21(31)16-4-3-5-17(23)19(16)20-18(24)7-25-28-20/h3-7,14-15H,8-11H2,1-2H3,(H,25,28) |
| InChIKey | KPIGJXMNYXKMSQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |