C26H25FN6O — CID 170965333
[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methanone (PubChem CID 170965333) has the molecular formula C26H25FN6O and a molecular weight of 456.53 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 170965333 |
| Molecular Formula | C26H25FN6O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4c(-c5ccccc5F)nc5ccccn45)CC3C2)n1 |
| InChI | InChI=1S/C26H25FN6O/c1-16-11-17(2)29-26(28-16)32-14-18-12-31(13-19(18)15-32)25(34)24-23(20-7-3-4-8-21(20)27)30-22-9-5-6-10-33(22)24/h3-11,18-19H,12-15H2,1-2H3 |
| InChIKey | XKCRBMAKEWGVQR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |