C28H29N5O — CID 172549894
[(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methylphenyl)indolizin-1-yl]methanone (PubChem CID 172549894) has the molecular formula C28H29N5O and a molecular weight of 451.57 g/mol. Its IUPAC name is [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methylphenyl)indolizin-1-yl]methanone.
| Compound Name | [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methylphenyl)indolizin-1-yl]methanone |
|---|---|
| PubChem CID | 172549894 |
| Molecular Formula | C28H29N5O |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methylphenyl)indolizin-1-yl]methanone |
| SMILES | Cc1cc(C)nc(N2C[C@H]3CN(C(=O)c4c(-c5ccccc5C)cn5ccccc45)C[C@H]3C2)n1 |
| InChI | InChI=1S/C28H29N5O/c1-18-8-4-5-9-23(18)24-17-31-11-7-6-10-25(31)26(24)27(34)32-13-21-15-33(16-22(21)14-32)28-29-19(2)12-20(3)30-28/h4-12,17,21-22H,13-16H2,1-3H3/t21-,22+ |
| InChIKey | UPDGZVAEJBYGRE-SZPZYZBQSA-N |
| XLogP | 4.53 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |