C25H26N6OS — CID 172549906
[(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(5-methyl-1,3-thiazol-2-yl)indolizin-1-yl]methanone (PubChem CID 172549906) has the molecular formula C25H26N6OS and a molecular weight of 458.59 g/mol. Its IUPAC name is [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(5-methyl-1,3-thiazol-2-yl)indolizin-1-yl]methanone.
| Compound Name | [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(5-methyl-1,3-thiazol-2-yl)indolizin-1-yl]methanone |
|---|---|
| PubChem CID | 172549906 |
| Molecular Formula | C25H26N6OS |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(3aR,6aS)-2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(5-methyl-1,3-thiazol-2-yl)indolizin-1-yl]methanone |
| SMILES | Cc1cc(C)nc(N2C[C@H]3CN(C(=O)c4c(-c5ncc(C)s5)cn5ccccc45)C[C@H]3C2)n1 |
| InChI | InChI=1S/C25H26N6OS/c1-15-8-16(2)28-25(27-15)31-12-18-10-30(11-19(18)13-31)24(32)22-20(23-26-9-17(3)33-23)14-29-7-5-4-6-21(22)29/h4-9,14,18-19H,10-13H2,1-3H3/t18-,19+ |
| InChIKey | PNKPCNLLRPXYMR-KDURUIRLSA-N |
| XLogP | 3.99 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |