C24H23ClN4O2 — CID 52917245
[2-(3-chlorophenyl)phenyl]-[2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 52917245) has the molecular formula C24H23ClN4O2 and a molecular weight of 434.93 g/mol. Its IUPAC name is [2-(3-chlorophenyl)phenyl]-[2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-(3-chlorophenyl)phenyl]-[2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 52917245 |
| Molecular Formula | C24H23ClN4O2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [2-(3-chlorophenyl)phenyl]-[2-(4-methoxypyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | COc1ccnc(N2CC3CN(C(=O)c4ccccc4-c4cccc(Cl)c4)CC3C2)n1 |
| InChI | InChI=1S/C24H23ClN4O2/c1-31-22-9-10-26-24(27-22)29-14-17-12-28(13-18(17)15-29)23(30)21-8-3-2-7-20(21)16-5-4-6-19(25)11-16/h2-11,17-18H,12-15H2,1H3 |
| InChIKey | XIMJBEIRWFTLGH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |