C27H23FN6O — CID 52917816
(5-fluoro-2-pyrimidin-2-ylphenyl)-[2-(4-phenylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 52917816) has the molecular formula C27H23FN6O and a molecular weight of 466.52 g/mol. Its IUPAC name is (5-fluoro-2-pyrimidin-2-ylphenyl)-[2-(4-phenylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (5-fluoro-2-pyrimidin-2-ylphenyl)-[2-(4-phenylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 52917816 |
| Molecular Formula | C27H23FN6O |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (5-fluoro-2-pyrimidin-2-ylphenyl)-[2-(4-phenylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1-c1ncccn1)N1CC2CN(c3nccc(-c4ccccc4)n3)CC2C1 |
| InChI | InChI=1S/C27H23FN6O/c28-21-7-8-22(25-29-10-4-11-30-25)23(13-21)26(35)33-14-19-16-34(17-20(19)15-33)27-31-12-9-24(32-27)18-5-2-1-3-6-18/h1-13,19-20H,14-17H2 |
| InChIKey | XHXFKEFWJIAYJZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |