C9H16N4O — CID 123191696
[5-(1-iminopropan-2-yl)-1-propan-2-yl-1,2,4-triazol-3-yl]methanol (PubChem CID 123191696) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [5-(1-iminopropan-2-yl)-1-propan-2-yl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(1-iminopropan-2-yl)-1-propan-2-yl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 123191696 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [5-(1-iminopropan-2-yl)-1-propan-2-yl-1,2,4-triazol-3-yl]methanol |
| SMILES | [H]/N=C/C(C)c1nc(CO)nn1C(C)C |
| InChI | InChI=1S/C9H16N4O/c1-6(2)13-9(7(3)4-10)11-8(5-14)12-13/h4,6-7,10,14H,5H2,1-3H3/b10-4+ |
| InChIKey | MUYDZYOBFNAECC-ONNFQVAWSA-N |
| XLogP | 1.10 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|