C10H20N4O — CID 50958564
2-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propylamino]propan-1-ol (PubChem CID 50958564) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propylamino]propan-1-ol.
| Compound Name | 2-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propylamino]propan-1-ol |
|---|---|
| PubChem CID | 50958564 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propylamino]propan-1-ol |
| SMILES | Cc1nc(C)n(CCCNC(C)CO)n1 |
| InChI | InChI=1S/C10H20N4O/c1-8(7-15)11-5-4-6-14-10(3)12-9(2)13-14/h8,11,15H,4-7H2,1-3H3 |
| InChIKey | NKZSFYMANRGKNV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|