C6H12N4O — CID 150973051
2-[5-(2-aminoethyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 150973051) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-[5-(2-aminoethyl)-1,2,4-triazol-1-yl]ethanol.
| Compound Name | 2-[5-(2-aminoethyl)-1,2,4-triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 150973051 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-[5-(2-aminoethyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | NCCc1ncnn1CCO |
| InChI | InChI=1S/C6H12N4O/c7-2-1-6-8-5-9-10(6)3-4-11/h5,11H,1-4,7H2 |
| InChIKey | LONDKALMZCZRMW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |