C22H24N6O3 — CID 123192601
2-[3-[3-[4-(aminomethyl)phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]ethylurea (PubChem CID 123192601) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[3-[3-[4-(aminomethyl)phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]ethylurea.
| Compound Name | 2-[3-[3-[4-(aminomethyl)phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]ethylurea |
|---|---|
| PubChem CID | 123192601 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[3-[3-[4-(aminomethyl)phenyl]-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]ethylurea |
| SMILES | NCc1ccc(N2C=C3C=C(c4cccc(OCCNC(N)=O)c4)NC3NC2=O)cc1 |
| InChI | InChI=1S/C22H24N6O3/c23-12-14-4-6-17(7-5-14)28-13-16-11-19(26-20(16)27-22(28)30)15-2-1-3-18(10-15)31-9-8-25-21(24)29/h1-7,10-11,13,20,26H,8-9,12,23H2,(H,27,30)(H3,24,25,29) |
| InChIKey | LSPBOZZVAJIVPM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 134.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|