C9H14ClN5 — CID 123192809
5-chloro-4-N-piperidin-4-ylpyrimidine-4,6-diamine (PubChem CID 123192809) has the molecular formula C9H14ClN5 and a molecular weight of 227.70 g/mol. Its IUPAC name is 5-chloro-4-N-piperidin-4-ylpyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 123192809 |
| Molecular Formula | C9H14ClN5 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-chloro-4-N-piperidin-4-ylpyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NC2CCNCC2)c1Cl |
| InChI | InChI=1S/C9H14ClN5/c10-7-8(11)13-5-14-9(7)15-6-1-3-12-4-2-6/h5-6,12H,1-4H2,(H3,11,13,14,15) |
| InChIKey | RABZUDIBJGYOIJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |