C26H39N3O4 — CID 123193350
4-O-[[amino-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]amino] 1-O-tert-butyl piperidine-1,4-dicarboxylate (PubChem CID 123193350) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-O-[[amino-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]amino] 1-O-tert-butyl piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-[[amino-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]amino] 1-O-tert-butyl piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 123193350 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 4-O-[[amino-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylidene]amino] 1-O-tert-butyl piperidine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)ON=C(N)c2ccc3c(c2)C(C)(C)CCC3(C)C)CC1 |
| InChI | InChI=1S/C26H39N3O4/c1-24(2,3)32-23(31)29-14-10-17(11-15-29)22(30)33-28-21(27)18-8-9-19-20(16-18)26(6,7)13-12-25(19,4)5/h8-9,16-17H,10-15H2,1-7H3,(H2,27,28) |
| InChIKey | ZCFLGFFUJDEMPK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|