C7H9F3 — CID 123193679
1,3,5-trifluoro-2-methylidenecyclohexane (PubChem CID 123193679) has the molecular formula C7H9F3 and a molecular weight of 150.14 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-methylidenecyclohexane.
| Compound Name | 1,3,5-trifluoro-2-methylidenecyclohexane |
|---|---|
| PubChem CID | 123193679 |
| Molecular Formula | C7H9F3 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1,3,5-trifluoro-2-methylidenecyclohexane |
| SMILES | C=C1C(F)CC(F)CC1F |
| InChI | InChI=1S/C7H9F3/c1-4-6(9)2-5(8)3-7(4)10/h5-7H,1-3H2 |
| InChIKey | NLWXJWYOALZCPT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|