C11H13ClFNO — CID 90701663
4-chloro-2-cyclopropyl-6-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1,3-benzoxazole (PubChem CID 90701663) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is 4-chloro-2-cyclopropyl-6-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1,3-benzoxazole.
| Compound Name | 4-chloro-2-cyclopropyl-6-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1,3-benzoxazole |
|---|---|
| PubChem CID | 90701663 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-chloro-2-cyclopropyl-6-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1,3-benzoxazole |
| SMILES | C=C1C(F)CC(Cl)C2N=C(C3CC3)OC12 |
| InChI | InChI=1S/C11H13ClFNO/c1-5-8(13)4-7(12)9-10(5)15-11(14-9)6-2-3-6/h6-10H,1-4H2 |
| InChIKey | QNRBMXFPYMMUEV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|