C13H26N2 — CID 123197448
5-butan-2-yl-3,7-dimethyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine (PubChem CID 123197448) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-butan-2-yl-3,7-dimethyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine.
| Compound Name | 5-butan-2-yl-3,7-dimethyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123197448 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5-butan-2-yl-3,7-dimethyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-b]pyridine |
| SMILES | CCC(C)C1CC2C(C)CNC2N(C)C1 |
| InChI | InChI=1S/C13H26N2/c1-5-9(2)11-6-12-10(3)7-14-13(12)15(4)8-11/h9-14H,5-8H2,1-4H3 |
| InChIKey | DJOCOKWLADBYQK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |