C12H11Cl2FN2OS — CID 123198314
4-(2,4-dichloro-3-isothiocyanatophenyl)-2-fluoro-2-methylbutanamide (PubChem CID 123198314) has the molecular formula C12H11Cl2FN2OS and a molecular weight of 321.20 g/mol. Its IUPAC name is 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-fluoro-2-methylbutanamide.
| Compound Name | 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-fluoro-2-methylbutanamide |
|---|---|
| PubChem CID | 123198314 |
| Molecular Formula | C12H11Cl2FN2OS |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-fluoro-2-methylbutanamide |
| SMILES | CC(F)(CCc1ccc(Cl)c(N=C=S)c1Cl)C(N)=O |
| InChI | InChI=1S/C12H11Cl2FN2OS/c1-12(15,11(16)18)5-4-7-2-3-8(13)10(9(7)14)17-6-19/h2-3H,4-5H2,1H3,(H2,16,18) |
| InChIKey | UTFZMWNNQCYXOY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|