C13H11Cl2F3N2OS — CID 123985293
4-(2,4-dichloro-3-isothiocyanatophenyl)-2-methyl-2-(trifluoromethyl)butanamide (PubChem CID 123985293) has the molecular formula C13H11Cl2F3N2OS and a molecular weight of 371.21 g/mol. Its IUPAC name is 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-methyl-2-(trifluoromethyl)butanamide.
| Compound Name | 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-methyl-2-(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 123985293 |
| Molecular Formula | C13H11Cl2F3N2OS |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 4-(2,4-dichloro-3-isothiocyanatophenyl)-2-methyl-2-(trifluoromethyl)butanamide |
| SMILES | CC(CCc1ccc(Cl)c(N=C=S)c1Cl)(C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C13H11Cl2F3N2OS/c1-12(11(19)21,13(16,17)18)5-4-7-2-3-8(14)10(9(7)15)20-6-22/h2-3H,4-5H2,1H3,(H2,19,21) |
| InChIKey | DNSUDIOKELNYID-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|