C9H14N2O — CID 123200606
(3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-yl)methanol (PubChem CID 123200606) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-yl)methanol.
| Compound Name | (3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-yl)methanol |
|---|---|
| PubChem CID | 123200606 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-yl)methanol |
| SMILES | Cc1[nH]nc2c1CCC(CO)C2 |
| InChI | InChI=1S/C9H14N2O/c1-6-8-3-2-7(5-12)4-9(8)11-10-6/h7,12H,2-5H2,1H3,(H,10,11) |
| InChIKey | JJVQAPLANNTIFJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |