C37H45N7O2 — CID 123206271
3-tert-butyl-N-[4-methyl-3-[5-methyl-4-[[(methylideneamino)-[4-(4-methylpiperazin-1-yl)anilino]methylidene]amino]-6-oxo-2,3-dihydropyridin-1-yl]phenyl]benzamide (PubChem CID 123206271) has the molecular formula C37H45N7O2 and a molecular weight of 619.81 g/mol. Its IUPAC name is 3-tert-butyl-N-[4-methyl-3-[5-methyl-4-[[(methylideneamino)-[4-(4-methylpiperazin-1-yl)anilino]methylidene]amino]-6-oxo-2,3-dihydropyridin-1-yl]phenyl]benzamide.
| Compound Name | 3-tert-butyl-N-[4-methyl-3-[5-methyl-4-[[(methylideneamino)-[4-(4-methylpiperazin-1-yl)anilino]methylidene]amino]-6-oxo-2,3-dihydropyridin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 123206271 |
| Molecular Formula | C37H45N7O2 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.36 |
| IUPAC Name | 3-tert-butyl-N-[4-methyl-3-[5-methyl-4-[[(methylideneamino)-[4-(4-methylpiperazin-1-yl)anilino]methylidene]amino]-6-oxo-2,3-dihydropyridin-1-yl]phenyl]benzamide |
| SMILES | C=N/C(=N\C1=C(C)C(=O)N(c2cc(NC(=O)c3cccc(C(C)(C)C)c3)ccc2C)CC1)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C37H45N7O2/c1-25-11-12-30(39-34(45)27-9-8-10-28(23-27)37(3,4)5)24-33(25)44-18-17-32(26(2)35(44)46)41-36(38-6)40-29-13-15-31(16-14-29)43-21-19-42(7)20-22-43/h8-16,23-24H,6,17-22H2,1-5,7H3,(H,39,45)(H,40,41) |
| InChIKey | BBPWZQTZEWYZPD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|