C11H22N2 — CID 123206751
2-ethyl-1-methyl-1-octa-2,5-dienylhydrazine (PubChem CID 123206751) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethyl-1-methyl-1-octa-2,5-dienylhydrazine.
| Compound Name | 2-ethyl-1-methyl-1-octa-2,5-dienylhydrazine |
|---|---|
| PubChem CID | 123206751 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-ethyl-1-methyl-1-octa-2,5-dienylhydrazine |
| SMILES | CCC=CCC=CCN(C)NCC |
| InChI | InChI=1S/C11H22N2/c1-4-6-7-8-9-10-11-13(3)12-5-2/h6-7,9-10,12H,4-5,8,11H2,1-3H3 |
| InChIKey | OFOHLMOGNOUIJY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|