C18H16Cl2F2N2O10S2 — CID 123207486
(5S)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)hexane-1,6-disulfonic acid (PubChem CID 123207486) has the molecular formula C18H16Cl2F2N2O10S2 and a molecular weight of 593.37 g/mol. Its IUPAC name is (5S)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)hexane-1,6-disulfonic acid.
| Compound Name | (5S)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)hexane-1,6-disulfonic acid |
|---|---|
| PubChem CID | 123207486 |
| Molecular Formula | C18H16Cl2F2N2O10S2 |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 591.96 |
| IUPAC Name | (5S)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)hexane-1,6-disulfonic acid |
| SMILES | O=[N+]([O-])c1cc(C(CC[C@H](CS(=O)(=O)O)c2cc([N+](=O)[O-])c(Cl)cc2F)CS(=O)(=O)O)c(F)cc1Cl |
| InChI | InChI=1S/C18H16Cl2F2N2O10S2/c19-13-5-15(21)11(3-17(13)23(25)26)9(7-35(29,30)31)1-2-10(8-36(32,33)34)12-4-18(24(27)28)14(20)6-16(12)22/h3-6,9-10H,1-2,7-8H2,(H,29,30,31)(H,32,33,34)/t9-,10?/m1/s1 |
| InChIKey | PVRBWAIABQZILW-YHMJZVADSA-N |
| XLogP | 4.51 |
| TPSA | 195.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|