C18H16Cl2F2N2O10S2 — CID 58032057
[(1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)-4-methylsulfonyloxybutyl] methanesulfonate (PubChem CID 58032057) has the molecular formula C18H16Cl2F2N2O10S2 and a molecular weight of 593.37 g/mol. Its IUPAC name is [(1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)-4-methylsulfonyloxybutyl] methanesulfonate.
| Compound Name | [(1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)-4-methylsulfonyloxybutyl] methanesulfonate |
|---|---|
| PubChem CID | 58032057 |
| Molecular Formula | C18H16Cl2F2N2O10S2 |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 591.96 |
| IUPAC Name | [(1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)-4-methylsulfonyloxybutyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H](CC[C@H](OS(C)(=O)=O)c1cc([N+](=O)[O-])c(Cl)cc1F)c1cc([N+](=O)[O-])c(Cl)cc1F |
| InChI | InChI=1S/C18H16Cl2F2N2O10S2/c1-35(29,30)33-17(9-5-15(23(25)26)11(19)7-13(9)21)3-4-18(34-36(2,31)32)10-6-16(24(27)28)12(20)8-14(10)22/h5-8,17-18H,3-4H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | CZWTYSISLJZVBX-ROUUACIJSA-N |
| XLogP | 4.60 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|