C9H8FNO7S — CID 150841110
2-(5-fluoro-2-nitrophenyl)-2-methylsulfonyloxyacetic acid (PubChem CID 150841110) has the molecular formula C9H8FNO7S and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-(5-fluoro-2-nitrophenyl)-2-methylsulfonyloxyacetic acid.
| Compound Name | 2-(5-fluoro-2-nitrophenyl)-2-methylsulfonyloxyacetic acid |
|---|---|
| PubChem CID | 150841110 |
| Molecular Formula | C9H8FNO7S |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-(5-fluoro-2-nitrophenyl)-2-methylsulfonyloxyacetic acid |
| SMILES | CS(=O)(=O)OC(C(=O)O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8FNO7S/c1-19(16,17)18-8(9(12)13)6-4-5(10)2-3-7(6)11(14)15/h2-4,8H,1H3,(H,12,13) |
| InChIKey | KNZVNPZSDSECKJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|