C15H32O2 — CID 123209317
1-(2,3-dimethylpentan-2-yloxy)-2,2,4-trimethylpentan-1-ol (PubChem CID 123209317) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1-(2,3-dimethylpentan-2-yloxy)-2,2,4-trimethylpentan-1-ol.
| Compound Name | 1-(2,3-dimethylpentan-2-yloxy)-2,2,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 123209317 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | 1-(2,3-dimethylpentan-2-yloxy)-2,2,4-trimethylpentan-1-ol |
| SMILES | CCC(C)C(C)(C)OC(O)C(C)(C)CC(C)C |
| InChI | InChI=1S/C15H32O2/c1-9-12(4)15(7,8)17-13(16)14(5,6)10-11(2)3/h11-13,16H,9-10H2,1-8H3 |
| InChIKey | YBXTWCIMZAWLDB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|