C12H17F3O — CID 123210225
4-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]pentan-1-ol (PubChem CID 123210225) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]pentan-1-ol.
| Compound Name | 4-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 123210225 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]pentan-1-ol |
| SMILES | CC(CCCO)C1=CCC(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C12H17F3O/c1-9(3-2-8-16)10-4-6-11(7-5-10)12(13,14)15/h4-6,9,11,16H,2-3,7-8H2,1H3 |
| InChIKey | QEBHFMYNTYCHBH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |