C30H49F2N3O7 — CID 123212089
(2,5-dihydroxypyrrol-1-yl) 4-[[3-[3-[3-(1,1-difluoropropyl)non-8-enoylamino]-3-methylbutoxy]-3-methylbutyl]amino]-4-oxobutanoate (PubChem CID 123212089) has the molecular formula C30H49F2N3O7 and a molecular weight of 601.73 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[[3-[3-[3-(1,1-difluoropropyl)non-8-enoylamino]-3-methylbutoxy]-3-methylbutyl]amino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-[3-[3-(1,1-difluoropropyl)non-8-enoylamino]-3-methylbutoxy]-3-methylbutyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123212089 |
| Molecular Formula | C30H49F2N3O7 |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-[3-[3-(1,1-difluoropropyl)non-8-enoylamino]-3-methylbutoxy]-3-methylbutyl]amino]-4-oxobutanoate |
| SMILES | C=CCCCCC(CC(=O)NC(C)(C)CCOC(C)(C)CCNC(=O)CCC(=O)On1c(O)ccc1O)C(F)(F)CC |
| InChI | InChI=1S/C30H49F2N3O7/c1-7-9-10-11-12-22(30(31,32)8-2)21-24(37)34-28(3,4)18-20-41-29(5,6)17-19-33-23(36)13-16-27(40)42-35-25(38)14-15-26(35)39/h7,14-15,22,38-39H,1,8-13,16-21H2,2-6H3,(H,33,36)(H,34,37) |
| InChIKey | HNQOJWQZNLKIHU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|