C22H38N2O5 — CID 91239225
(2,5-dihydroxypyrrol-1-yl) 2-(2-hexyldecanoylamino)acetate (PubChem CID 91239225) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-hexyldecanoylamino)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-hexyldecanoylamino)acetate |
|---|---|
| PubChem CID | 91239225 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-hexyldecanoylamino)acetate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)NCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C22H38N2O5/c1-3-5-7-9-10-12-14-18(13-11-8-6-4-2)22(28)23-17-21(27)29-24-19(25)15-16-20(24)26/h15-16,18,25-26H,3-14,17H2,1-2H3,(H,23,28) |
| InChIKey | KBYIGZIQONPKHN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|