C28H41N3O9 — CID 123141812
cyclooct-4-yn-1-yl 4-[3-[4-[[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutanoyl]amino]-2-methylbutan-2-yl]oxypropylamino]-4-oxobutanoate (PubChem CID 123141812) has the molecular formula C28H41N3O9 and a molecular weight of 563.65 g/mol. Its IUPAC name is cyclooct-4-yn-1-yl 4-[3-[4-[[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutanoyl]amino]-2-methylbutan-2-yl]oxypropylamino]-4-oxobutanoate.
| Compound Name | cyclooct-4-yn-1-yl 4-[3-[4-[[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutanoyl]amino]-2-methylbutan-2-yl]oxypropylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123141812 |
| Molecular Formula | C28H41N3O9 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | cyclooct-4-yn-1-yl 4-[3-[4-[[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutanoyl]amino]-2-methylbutan-2-yl]oxypropylamino]-4-oxobutanoate |
| SMILES | CC(C)(CCNC(=O)CCC(=O)On1c(O)ccc1O)OCCCNC(=O)CCC(=O)OC1CCC#CCCC1 |
| InChI | InChI=1S/C28H41N3O9/c1-28(2,17-19-30-23(33)12-16-27(37)40-31-24(34)13-14-25(31)35)38-20-8-18-29-22(32)11-15-26(36)39-21-9-6-4-3-5-7-10-21/h13-14,21,34-35H,4,6-12,15-20H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | SSMSKNHFTSVBHX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|