C23H35N3O8 — CID 123881623
(2,5-dihydroxypyrrol-1-yl) 4-[3-[[3-(2,5-dioxopyrrol-1-yl)propylamino]methoxy]-3-methylbutoxy]-4-methylpentanoate (PubChem CID 123881623) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[3-[[3-(2,5-dioxopyrrol-1-yl)propylamino]methoxy]-3-methylbutoxy]-4-methylpentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[3-[[3-(2,5-dioxopyrrol-1-yl)propylamino]methoxy]-3-methylbutoxy]-4-methylpentanoate |
|---|---|
| PubChem CID | 123881623 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[3-[[3-(2,5-dioxopyrrol-1-yl)propylamino]methoxy]-3-methylbutoxy]-4-methylpentanoate |
| SMILES | CC(C)(CCC(=O)On1c(O)ccc1O)OCCC(C)(C)OCNCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H35N3O8/c1-22(2,11-10-21(31)34-26-19(29)8-9-20(26)30)32-15-12-23(3,4)33-16-24-13-5-14-25-17(27)6-7-18(25)28/h6-9,24,29-30H,5,10-16H2,1-4H3 |
| InChIKey | IEIDFMCSGRHMOW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|