C25H32N2O9 — CID 123856430
(2,5-dihydroxypyrrol-1-yl) 3-[3-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3-methylbutoxy]-3-methylpentanoate (PubChem CID 123856430) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[3-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3-methylbutoxy]-3-methylpentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[3-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3-methylbutoxy]-3-methylpentanoate |
|---|---|
| PubChem CID | 123856430 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[3-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3-methylbutoxy]-3-methylpentanoate |
| SMILES | CCC(C)(CC(=O)On1c(O)ccc1O)OCCC(C)(C)OCCON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H32N2O9/c1-5-25(4,16-21(30)36-26-19(28)10-11-20(26)29)34-13-12-24(2,3)33-14-15-35-27-22(31)17-8-6-7-9-18(17)23(27)32/h6-11,28-29H,5,12-16H2,1-4H3 |
| InChIKey | LJZMDZJGINBWRX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|