C12H11N3O9S — CID 123632077
(2,5-dihydroxy-3-nitrososulfonylpyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 123632077) has the molecular formula C12H11N3O9S and a molecular weight of 373.30 g/mol. Its IUPAC name is (2,5-dihydroxy-3-nitrososulfonylpyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | (2,5-dihydroxy-3-nitrososulfonylpyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 123632077 |
| Molecular Formula | C12H11N3O9S |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (2,5-dihydroxy-3-nitrososulfonylpyrrol-1-yl) 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | O=NS(=O)(=O)c1cc(O)n(OC(=O)CCCN2C(=O)C=CC2=O)c1O |
| InChI | InChI=1S/C12H11N3O9S/c16-8-3-4-9(17)14(8)5-1-2-11(19)24-15-10(18)6-7(12(15)20)25(22,23)13-21/h3-4,6,18,20H,1-2,5H2 |
| InChIKey | BBAWANRECSYRGU-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|