C16H24N2O9 — CID 123865227
(2,5-dihydroxypyrrol-1-yl) 4-[2-(3,4-dihydroxy-6-methyloxan-2-yl)oxyethylamino]-4-oxobutanoate (PubChem CID 123865227) has the molecular formula C16H24N2O9 and a molecular weight of 388.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[2-(3,4-dihydroxy-6-methyloxan-2-yl)oxyethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(3,4-dihydroxy-6-methyloxan-2-yl)oxyethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123865227 |
| Molecular Formula | C16H24N2O9 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(3,4-dihydroxy-6-methyloxan-2-yl)oxyethylamino]-4-oxobutanoate |
| SMILES | CC1CC(O)C(O)C(OCCNC(=O)CCC(=O)On2c(O)ccc2O)O1 |
| InChI | InChI=1S/C16H24N2O9/c1-9-8-10(19)15(24)16(26-9)25-7-6-17-11(20)2-5-14(23)27-18-12(21)3-4-13(18)22/h3-4,9-10,15-16,19,21-22,24H,2,5-8H2,1H3,(H,17,20) |
| InChIKey | MUNUKILENQILKY-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|