C20H36N2O8 — CID 155384355
N'-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-N-[2-(3-hydroxyoxan-2-yl)oxyethyl]pentanediamide (PubChem CID 155384355) has the molecular formula C20H36N2O8 and a molecular weight of 432.51 g/mol. Its IUPAC name is N'-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-N-[2-(3-hydroxyoxan-2-yl)oxyethyl]pentanediamide.
| Compound Name | N'-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-N-[2-(3-hydroxyoxan-2-yl)oxyethyl]pentanediamide |
|---|---|
| PubChem CID | 155384355 |
| Molecular Formula | C20H36N2O8 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | N'-[2-[(6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]-N-[2-(3-hydroxyoxan-2-yl)oxyethyl]pentanediamide |
| SMILES | C[C@H]1CCC(O)C(OCCNC(=O)CCCC(=O)NCCOC2OCCCC2O)O1 |
| InChI | InChI=1S/C20H36N2O8/c1-14-7-8-16(24)20(30-14)29-13-10-22-18(26)6-2-5-17(25)21-9-12-28-19-15(23)4-3-11-27-19/h14-16,19-20,23-24H,2-13H2,1H3,(H,21,25)(H,22,26)/t14-,15?,16?,19?,20?/m0/s1 |
| InChIKey | BVBSYGMXJFSOTR-HUYRZILQSA-N |
| XLogP | -0.19 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|