C30H53N3O10 — CID 134458079
(2S)-2-[(7,7-dimethyl-6-oxooctanoyl)amino]-N,N'-bis[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]butanediamide (PubChem CID 134458079) has the molecular formula C30H53N3O10 and a molecular weight of 615.77 g/mol. Its IUPAC name is (2S)-2-[(7,7-dimethyl-6-oxooctanoyl)amino]-N,N'-bis[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]butanediamide.
| Compound Name | (2S)-2-[(7,7-dimethyl-6-oxooctanoyl)amino]-N,N'-bis[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]butanediamide |
|---|---|
| PubChem CID | 134458079 |
| Molecular Formula | C30H53N3O10 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.37 |
| IUPAC Name | (2S)-2-[(7,7-dimethyl-6-oxooctanoyl)amino]-N,N'-bis[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethyl]butanediamide |
| SMILES | C[C@H]1CC[C@H](O)[C@H](OCCNC(=O)C[C@H](NC(=O)CCCCC(=O)C(C)(C)C)C(=O)NCCO[C@@H]2O[C@@H](C)CC[C@@H]2O)O1 |
| InChI | InChI=1S/C30H53N3O10/c1-19-10-12-22(34)28(42-19)40-16-14-31-26(38)18-21(33-25(37)9-7-6-8-24(36)30(3,4)5)27(39)32-15-17-41-29-23(35)13-11-20(2)43-29/h19-23,28-29,34-35H,6-18H2,1-5H3,(H,31,38)(H,32,39)(H,33,37)/t19-,20-,21-,22-,23-,28+,29+/m0/s1 |
| InChIKey | DPIPVTKWMAYREI-QNOJWGAOSA-N |
| XLogP | 1.07 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|