C25H44N2O7 — CID 91491182
(2,5-dihydroxypyrrol-1-yl) 2-[2-(2-hexyldecanoylamino)ethoxy]ethyl carbonate (PubChem CID 91491182) has the molecular formula C25H44N2O7 and a molecular weight of 484.63 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[2-(2-hexyldecanoylamino)ethoxy]ethyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[2-(2-hexyldecanoylamino)ethoxy]ethyl carbonate |
|---|---|
| PubChem CID | 91491182 |
| Molecular Formula | C25H44N2O7 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[2-(2-hexyldecanoylamino)ethoxy]ethyl carbonate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)NCCOCCOC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C25H44N2O7/c1-3-5-7-9-10-12-14-21(13-11-8-6-4-2)24(30)26-17-18-32-19-20-33-25(31)34-27-22(28)15-16-23(27)29/h15-16,21,28-29H,3-14,17-20H2,1-2H3,(H,26,30) |
| InChIKey | YAEMCCDUBVRTFF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|